About 4-bromobenzaldehyde;3-methylbutan-1-amine
4-bromobenzaldehyde;3-methylbutan-1-amine (PubChem CID 158618088) has the molecular formula C12H18BrNO
and a molecular weight of 272.19 g/mol. Its IUPAC name is 4-bromobenzaldehyde;3-methylbutan-1-amine.
Molecular Properties
| Compound Name | 4-bromobenzaldehyde;3-methylbutan-1-amine |
| PubChem CID | 158618088 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 4-bromobenzaldehyde;3-methylbutan-1-amine |
| SMILES | CC(C)CCN.O=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H5BrO.C5H13N/c8-7-3-1-6(5-9)2-4-7;1-5(2)3-4-6/h1-5H;5H,3-4,6H2,1-2H3 |
| InChIKey | HXQIXUGCIOQNAI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzaldehyde;3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzaldehyde;3-methylbutan-1-amine?
The IUPAC name of 4-bromobenzaldehyde;3-methylbutan-1-amine (CID 158618088) is 4-bromobenzaldehyde;3-methylbutan-1-amine.
What is the SMILES notation for 4-bromobenzaldehyde;3-methylbutan-1-amine?
The canonical SMILES for 4-bromobenzaldehyde;3-methylbutan-1-amine is CC(C)CCN.O=Cc1ccc(Br)cc1.
What is the InChIKey of 4-bromobenzaldehyde;3-methylbutan-1-amine?
The InChIKey is HXQIXUGCIOQNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.C5H13N/c8-7-3-1-6(5-9)2-4-7;1-5(2)3-4-6/h1-5H;5H,3-4,6H2,1-2H3.
What are the key properties of 4-bromobenzaldehyde;3-methylbutan-1-amine?
4-bromobenzaldehyde;3-methylbutan-1-amine has a molecular weight of 272.19 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzaldehyde;3-methylbutan-1-amine is sourced from PubChem (CID 158618088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).