About dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol
dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol (PubChem CID 158618699) has the molecular formula C13H14Cl2N2OZr
and a molecular weight of 376.40 g/mol. Its IUPAC name is dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol.
Molecular Properties
| Compound Name | dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol |
| PubChem CID | 158618699 |
| Molecular Formula | C13H14Cl2N2OZr |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol |
| SMILES | Cc1cc(C)c(O)c(C=Nn2cccc2)c1.Cl[Zr]Cl |
| InChI | InChI=1S/C13H14N2O.2ClH.Zr/c1-10-7-11(2)13(16)12(8-10)9-14-15-5-3-4-6-15;;;/h3-9,16H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YAXOOWPPIKFWPF-UHFFFAOYSA-L |
| XLogP | 4.07 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol?
The IUPAC name of dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol (CID 158618699) is dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol.
What is the SMILES notation for dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol?
The canonical SMILES for dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol is Cc1cc(C)c(O)c(C=Nn2cccc2)c1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol?
The InChIKey is YAXOOWPPIKFWPF-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H14N2O.2ClH.Zr/c1-10-7-11(2)13(16)12(8-10)9-14-15-5-3-4-6-15;;;/h3-9,16H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol?
dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol has a molecular weight of 376.40 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;2,4-dimethyl-6-(pyrrol-1-yliminomethyl)phenol is sourced from PubChem (CID 158618699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).