About tripyridin-4-ylmethanol
tripyridin-4-ylmethanol (PubChem CID 15861888) has the molecular formula C16H13N3O
and a molecular weight of 263.30 g/mol. Its IUPAC name is tripyridin-4-ylmethanol.
Molecular Properties
| Compound Name | tripyridin-4-ylmethanol |
| PubChem CID | 15861888 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | tripyridin-4-ylmethanol |
| SMILES | OC(c1ccncc1)(c1ccncc1)c1ccncc1 |
| InChI | InChI=1S/C16H13N3O/c20-16(13-1-7-17-8-2-13,14-3-9-18-10-4-14)15-5-11-19-12-6-15/h1-12,20H |
| InChIKey | LGHLTRASRAEIPD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tripyridin-4-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripyridin-4-ylmethanol?
The IUPAC name of tripyridin-4-ylmethanol (CID 15861888) is tripyridin-4-ylmethanol.
What is the SMILES notation for tripyridin-4-ylmethanol?
The canonical SMILES for tripyridin-4-ylmethanol is OC(c1ccncc1)(c1ccncc1)c1ccncc1.
What is the InChIKey of tripyridin-4-ylmethanol?
The InChIKey is LGHLTRASRAEIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O/c20-16(13-1-7-17-8-2-13,14-3-9-18-10-4-14)15-5-11-19-12-6-15/h1-12,20H.
What are the key properties of tripyridin-4-ylmethanol?
tripyridin-4-ylmethanol has a molecular weight of 263.30 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tripyridin-4-ylmethanol is sourced from PubChem (CID 15861888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).