About methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole
methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole (PubChem CID 158620122) has the molecular formula C11H15N5
and a molecular weight of 217.28 g/mol. Its IUPAC name is methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole.
Molecular Properties
| Compound Name | methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole |
| PubChem CID | 158620122 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole |
| SMILES | CCCN1C=CN(C)C1.N#CC(C#N)C#N |
| InChI | InChI=1S/C7H14N2.C4HN3/c1-3-4-9-6-5-8(2)7-9;5-1-4(2-6)3-7/h5-6H,3-4,7H2,1-2H3;4H |
| InChIKey | HXWUMFGZYZHXSD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole?
The IUPAC name of methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole (CID 158620122) is methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole.
What is the SMILES notation for methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole?
The canonical SMILES for methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole is CCCN1C=CN(C)C1.N#CC(C#N)C#N.
What is the InChIKey of methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole?
The InChIKey is HXWUMFGZYZHXSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C4HN3/c1-3-4-9-6-5-8(2)7-9;5-1-4(2-6)3-7/h5-6H,3-4,7H2,1-2H3;4H.
What are the key properties of methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole?
methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole has a molecular weight of 217.28 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanetricarbonitrile;1-methyl-3-propyl-2H-imidazole is sourced from PubChem (CID 158620122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).