C44H37BF2N2O — CID 158620347
2,2-difluoro-8-(2-methoxyphenyl)-4,6,10,12-tetrakis(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 158620347) has the molecular formula C44H37BF2N2O and a molecular weight of 658.60 g/mol. Its IUPAC name is 2,2-difluoro-8-(2-methoxyphenyl)-4,6,10,12-tetrakis(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-(2-methoxyphenyl)-4,6,10,12-tetrakis(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 158620347 |
| Molecular Formula | C44H37BF2N2O |
| Molecular Weight | 658.60 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | 2,2-difluoro-8-(2-methoxyphenyl)-4,6,10,12-tetrakis(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccccc1C1=C2C(c3ccc(C)cc3)=CC(c3ccc(C)cc3)=[N+]2[B-](F)(F)n2c(-c3ccc(C)cc3)cc(-c3ccc(C)cc3)c21 |
| InChI | InChI=1S/C44H37BF2N2O/c1-28-10-18-32(19-11-28)37-26-39(34-22-14-30(3)15-23-34)48-43(37)42(36-8-6-7-9-41(36)50-5)44-38(33-20-12-29(2)13-21-33)27-40(49(44)45(48,46)47)35-24-16-31(4)17-25-35/h6-27H,1-5H3 |
| InChIKey | POUFHCIQJQEYHB-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.60 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|