About 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine
2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine (PubChem CID 158621536) has the molecular formula C24H23FN4
and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine.
Molecular Properties
| Compound Name | 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine |
| PubChem CID | 158621536 |
| Molecular Formula | C24H23FN4 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine |
| SMILES | Cc1ccc(-c2ncccn2)c(C)c1F.Cc1cccc(-c2ncccn2)c1C |
| InChI | InChI=1S/C12H11FN2.C12H12N2/c1-8-4-5-10(9(2)11(8)13)12-14-6-3-7-15-12;1-9-5-3-6-11(10(9)2)12-13-7-4-8-14-12/h3-7H,1-2H3;3-8H,1-2H3 |
| InChIKey | HYBDTVHYIBWNKU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine?
The IUPAC name of 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine (CID 158621536) is 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine.
What is the SMILES notation for 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine?
The canonical SMILES for 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine is Cc1ccc(-c2ncccn2)c(C)c1F.Cc1cccc(-c2ncccn2)c1C.
What is the InChIKey of 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine?
The InChIKey is HYBDTVHYIBWNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2.C12H12N2/c1-8-4-5-10(9(2)11(8)13)12-14-6-3-7-15-12;1-9-5-3-6-11(10(9)2)12-13-7-4-8-14-12/h3-7H,1-2H3;3-8H,1-2H3.
What are the key properties of 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine?
2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine has a molecular weight of 386.47 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylphenyl)pyrimidine;2-(3-fluoro-2,4-dimethylphenyl)pyrimidine is sourced from PubChem (CID 158621536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).