About 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole
4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole (PubChem CID 15862196) has the molecular formula C11H14Br2N4
and a molecular weight of 362.07 g/mol. Its IUPAC name is 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole |
| PubChem CID | 15862196 |
| Molecular Formula | C11H14Br2N4 |
| Molecular Weight | 362.07 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole |
| SMILES | Cc1nn(Cn2nc(C)c(Br)c2C)c(C)c1Br |
| InChI | InChI=1S/C11H14Br2N4/c1-6-10(12)8(3)16(14-6)5-17-9(4)11(13)7(2)15-17/h5H2,1-4H3 |
| InChIKey | LMFXQSMWZQNBJO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.07 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
The IUPAC name of 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole (CID 15862196) is 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole.
What is the SMILES notation for 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
The canonical SMILES for 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole is Cc1nn(Cn2nc(C)c(Br)c2C)c(C)c1Br.
What is the InChIKey of 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
The InChIKey is LMFXQSMWZQNBJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Br2N4/c1-6-10(12)8(3)16(14-6)5-17-9(4)11(13)7(2)15-17/h5H2,1-4H3.
What are the key properties of 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole has a molecular weight of 362.07 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole is sourced from PubChem (CID 15862196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).