About 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine
2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine (PubChem CID 158622412) has the molecular formula C14H15IN4
and a molecular weight of 366.21 g/mol. Its IUPAC name is 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine |
| PubChem CID | 158622412 |
| Molecular Formula | C14H15IN4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine |
| SMILES | Cc1[nH]c2cnccc2c1C.Nc1cnccc1I |
| InChI | InChI=1S/C9H10N2.C5H5IN2/c1-6-7(2)11-9-5-10-4-3-8(6)9;6-4-1-2-8-3-5(4)7/h3-5,11H,1-2H3;1-3H,7H2 |
| InChIKey | HYEADLUQDATXKA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine?
The IUPAC name of 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine (CID 158622412) is 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine.
What is the SMILES notation for 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine?
The canonical SMILES for 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine is Cc1[nH]c2cnccc2c1C.Nc1cnccc1I.
What is the InChIKey of 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine?
The InChIKey is HYEADLUQDATXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C5H5IN2/c1-6-7(2)11-9-5-10-4-3-8(6)9;6-4-1-2-8-3-5(4)7/h3-5,11H,1-2H3;1-3H,7H2.
What are the key properties of 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine?
2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine has a molecular weight of 366.21 g/mol, XLogP of 3.45, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine;4-iodopyridin-3-amine is sourced from PubChem (CID 158622412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).