C19H33BN2O — CID 158622874
[2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]piperidin-1-yl]-methylborinic acid;ethane (PubChem CID 158622874) has the molecular formula C19H33BN2O and a molecular weight of 316.30 g/mol. Its IUPAC name is [2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]piperidin-1-yl]-methylborinic acid;ethane.
| Compound Name | [2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]piperidin-1-yl]-methylborinic acid;ethane |
|---|---|
| PubChem CID | 158622874 |
| Molecular Formula | C19H33BN2O |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | [2-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]piperidin-1-yl]-methylborinic acid;ethane |
| SMILES | CB(O)N1CCCCC1CCNC1Cc2ccccc2C1.CC |
| InChI | InChI=1S/C17H27BN2O.C2H6/c1-18(21)20-11-5-4-8-17(20)9-10-19-16-12-14-6-2-3-7-15(14)13-16;1-2/h2-3,6-7,16-17,19,21H,4-5,8-13H2,1H3;1-2H3 |
| InChIKey | HYFLBJCBYJLHJA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|