C24H24FN5O2S2 — CID 158622960
methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-8-ethyl-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate (PubChem CID 158622960) has the molecular formula C24H24FN5O2S2 and a molecular weight of 497.62 g/mol. Its IUPAC name is methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-8-ethyl-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate.
| Compound Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-8-ethyl-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 158622960 |
| Molecular Formula | C24H24FN5O2S2 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | methyl 5-[[4-[(1R,4R,5R)-5-amino-2-bicyclo[2.2.1]heptanyl]-8-ethyl-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]sulfanyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCc1cc(F)cc2c1[nH]c1nc(Sc3cnc(C(=O)OC)s3)nc(C3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C24H24FN5O2S2/c1-3-10-5-13(25)8-15-18-20(14-6-12-4-11(14)7-16(12)26)29-24(30-21(18)28-19(10)15)34-17-9-27-22(33-17)23(31)32-2/h5,8-9,11-12,14,16H,3-4,6-7,26H2,1-2H3,(H,28,29,30)/t11-,12-,14?,16-/m1/s1 |
| InChIKey | PXDZJMIZOKYDMV-NZQXWLTISA-N |
| XLogP | 5.05 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |