C25H24FN7OS2 — CID 158622961
(1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 158622961) has the molecular formula C25H24FN7OS2 and a molecular weight of 521.65 g/mol. Its IUPAC name is (1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 158622961 |
| Molecular Formula | C25H24FN7OS2 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | (1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-5-yl]sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | CCc1cc(F)cc2c1[nH]c1nc(Sc3cnc(-c4nnc(C)o4)s3)nc(C3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C25H24FN7OS2/c1-3-11-5-14(26)8-16-19-21(15-6-13-4-12(15)7-17(13)27)30-25(31-22(19)29-20(11)16)36-18-9-28-24(35-18)23-33-32-10(2)34-23/h5,8-9,12-13,15,17H,3-4,6-7,27H2,1-2H3,(H,29,30,31)/t12-,13-,15?,17-/m1/s1 |
| InChIKey | UXPRLQGPQZFKCD-BPBCKMDWSA-N |
| XLogP | 5.62 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |