C17H30N2O4 — CID 158624697
1-[(2R,3S,5R)-5-acetyl-1-methyl-3-[(Z)-prop-1-enyl]pyrrolidin-2-yl]-1-amino-3-(1-ethoxyethoxy)propan-2-one (PubChem CID 158624697) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-5-acetyl-1-methyl-3-[(Z)-prop-1-enyl]pyrrolidin-2-yl]-1-amino-3-(1-ethoxyethoxy)propan-2-one.
| Compound Name | 1-[(2R,3S,5R)-5-acetyl-1-methyl-3-[(Z)-prop-1-enyl]pyrrolidin-2-yl]-1-amino-3-(1-ethoxyethoxy)propan-2-one |
|---|---|
| PubChem CID | 158624697 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 1-[(2R,3S,5R)-5-acetyl-1-methyl-3-[(Z)-prop-1-enyl]pyrrolidin-2-yl]-1-amino-3-(1-ethoxyethoxy)propan-2-one |
| SMILES | C/C=C\[C@@H]1C[C@H](C(C)=O)N(C)[C@H]1C(N)C(=O)COC(C)OCC |
| InChI | InChI=1S/C17H30N2O4/c1-6-8-13-9-14(11(3)20)19(5)17(13)16(18)15(21)10-23-12(4)22-7-2/h6,8,12-14,16-17H,7,9-10,18H2,1-5H3/b8-6-/t12?,13-,14-,16?,17-/m1/s1 |
| InChIKey | SXKYHNPEQOOBLA-DFCWWFTBSA-N |
| XLogP | 1.14 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|