C12H17N3O6S — CID 158624728
(2S)-3-(1H-imidazol-5-yl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid (PubChem CID 158624728) has the molecular formula C12H17N3O6S and a molecular weight of 331.35 g/mol. Its IUPAC name is (2S)-3-(1H-imidazol-5-yl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-(1H-imidazol-5-yl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 158624728 |
| Molecular Formula | C12H17N3O6S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2S)-3-(1H-imidazol-5-yl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@H]1CC[C@H](S(=O)(=O)O)C1 |
| InChI | InChI=1S/C12H17N3O6S/c16-11(7-1-2-9(3-7)22(19,20)21)15-10(12(17)18)4-8-5-13-6-14-8/h5-7,9-10H,1-4H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20,21)/t7-,9-,10-/m0/s1 |
| InChIKey | HYLFQDVVLVBBHZ-HGNGGELXSA-N |
| XLogP | -0.42 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|