C14H36Si6 — CID 15862621
1,1,3,3-Tetramethyl-2,2,4,4-tetrakis(dimethylsilyl)-1,3-disilacyclobutane (PubChem CID 15862621) has the molecular formula C14H36Si6 and a molecular weight of 372.96 g/mol.
| Compound Name | 1,1,3,3-Tetramethyl-2,2,4,4-tetrakis(dimethylsilyl)-1,3-disilacyclobutane |
|---|---|
| PubChem CID | 15862621 |
| Molecular Formula | C14H36Si6 |
| Molecular Weight | 372.96 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)C1([Si](C)C)[Si](C)(C)C([Si](C)C)([Si](C)C)[Si]1(C)C |
| InChI | InChI=1S/C14H36Si6/c1-15(2)13(16(3)4)19(9,10)14(17(5)6,18(7)8)20(13,11)12/h1-12H3 |
| InChIKey | UPKNSMMZGBWNAR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.96 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|