C10H11ClF3NO3S — CID 158627127
1,2,3,4-tetrahydroisoquinolin-8-yl trifluoromethanesulfonate;hydrochloride (PubChem CID 158627127) has the molecular formula C10H11ClF3NO3S and a molecular weight of 317.72 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinolin-8-yl trifluoromethanesulfonate;hydrochloride.
| Compound Name | 1,2,3,4-tetrahydroisoquinolin-8-yl trifluoromethanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 158627127 |
| Molecular Formula | C10H11ClF3NO3S |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinolin-8-yl trifluoromethanesulfonate;hydrochloride |
| SMILES | Cl.O=S(=O)(Oc1cccc2c1CNCC2)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO3S.ClH/c11-10(12,13)18(15,16)17-9-3-1-2-7-4-5-14-6-8(7)9;/h1-3,14H,4-6H2;1H |
| InChIKey | WHGDBRWECZIQON-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|