About 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine
2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine (PubChem CID 158628216) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine |
| PubChem CID | 158628216 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine |
| SMILES | Cc1cc2oc(Cl)nc2cn1 |
| InChI | InChI=1S/C7H5ClN2O/c1-4-2-6-5(3-9-4)10-7(8)11-6/h2-3H,1H3 |
| InChIKey | WATATGQMKBNLLY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine?
The IUPAC name of 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine (CID 158628216) is 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine.
What is the SMILES notation for 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine?
The canonical SMILES for 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine is Cc1cc2oc(Cl)nc2cn1.
What is the InChIKey of 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine?
The InChIKey is WATATGQMKBNLLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c1-4-2-6-5(3-9-4)10-7(8)11-6/h2-3H,1H3.
What are the key properties of 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine?
2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine has a molecular weight of 168.58 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methyl-[1,3]oxazolo[4,5-c]pyridine is sourced from PubChem (CID 158628216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).