About ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline
ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline (PubChem CID 158628580) has the molecular formula C17H18F2N2O3
and a molecular weight of 336.34 g/mol. Its IUPAC name is ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline.
Molecular Properties
| Compound Name | ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline |
| PubChem CID | 158628580 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline |
| SMILES | CCOC(=O)CC(=O)Nc1ccccc1F.Nc1ccccc1F |
| InChI | InChI=1S/C11H12FNO3.C6H6FN/c1-2-16-11(15)7-10(14)13-9-6-4-3-5-8(9)12;7-5-3-1-2-4-6(5)8/h3-6H,2,7H2,1H3,(H,13,14);1-4H,8H2 |
| InChIKey | HYXFHWJWCYEKRW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline?
The IUPAC name of ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline (CID 158628580) is ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline.
What is the SMILES notation for ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline?
The canonical SMILES for ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline is CCOC(=O)CC(=O)Nc1ccccc1F.Nc1ccccc1F.
What is the InChIKey of ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline?
The InChIKey is HYXFHWJWCYEKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO3.C6H6FN/c1-2-16-11(15)7-10(14)13-9-6-4-3-5-8(9)12;7-5-3-1-2-4-6(5)8/h3-6H,2,7H2,1H3,(H,13,14);1-4H,8H2.
What are the key properties of ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline?
ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline has a molecular weight of 336.34 g/mol, XLogP of 3.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2-fluoroanilino)-3-oxopropanoate;2-fluoroaniline is sourced from PubChem (CID 158628580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).