About CID 158629983
CID 158629983 (PubChem CID 158629983) has the molecular formula C32H18BBr3Cl2F2N5O2S
and a molecular weight of 896.02 g/mol.
Molecular Properties
| Compound Name | CID 158629983 |
| PubChem CID | 158629983 |
| Molecular Formula | C32H18BBr3Cl2F2N5O2S |
| Molecular Weight | 896.02 g/mol |
| Exact Mass | 891.82 |
| IUPAC Name | — |
| SMILES | O=C(Cc1ccc2ncc(Br)cc2n1)c1cc(Cl)ccc1F.O=C(c1cc(Cl)ccc1F)C(Br)c1ccc2ncc(Br)cc2n1.[B]=NS |
| InChI | InChI=1S/C16H8Br2ClFN2O.C16H9BrClFN2O.BHNS/c17-8-5-14-12(21-7-8)3-4-13(22-14)15(18)16(23)10-6-9(19)1-2-11(10)20;17-9-5-15-14(20-8-9)4-2-11(21-15)7-16(22)12-6-10(18)1-3-13(12)19;1-2-3/h1-7,15H;1-6,8H,7H2;3H |
| InChIKey | XUEBVUGKVSXSQL-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 896.02 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158629983 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158629983?
The IUPAC name of CID 158629983 (CID 158629983) is not available.
What is the SMILES notation for CID 158629983?
The canonical SMILES for CID 158629983 is O=C(Cc1ccc2ncc(Br)cc2n1)c1cc(Cl)ccc1F.O=C(c1cc(Cl)ccc1F)C(Br)c1ccc2ncc(Br)cc2n1.[B]=NS.
What is the InChIKey of CID 158629983?
The InChIKey is XUEBVUGKVSXSQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Br2ClFN2O.C16H9BrClFN2O.BHNS/c17-8-5-14-12(21-7-8)3-4-13(22-14)15(18)16(23)10-6-9(19)1-2-11(10)20;17-9-5-15-14(20-8-9)4-2-11(21-15)7-16(22)12-6-10(18)1-3-13(12)19;1-2-3/h1-7,15H;1-6,8H,7H2;3H.
What are the key properties of CID 158629983?
CID 158629983 has a molecular weight of 896.02 g/mol, XLogP of 10.30, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158629983 is sourced from PubChem (CID 158629983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).