About 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one
2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one (PubChem CID 158631009) has the molecular formula C18H20N4O2
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one.
Molecular Properties
| Compound Name | 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one |
| PubChem CID | 158631009 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one |
| SMILES | CC(C)=O.Cc1ccc2cccnc2n1.Nc1ncccc1C=O |
| InChI | InChI=1S/C9H8N2.C6H6N2O.C3H6O/c1-7-4-5-8-3-2-6-10-9(8)11-7;7-6-5(4-9)2-1-3-8-6;1-3(2)4/h2-6H,1H3;1-4H,(H2,7,8);1-2H3 |
| InChIKey | HZEQRXFHONUKJT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one?
The IUPAC name of 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one (CID 158631009) is 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one.
What is the SMILES notation for 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one?
The canonical SMILES for 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one is CC(C)=O.Cc1ccc2cccnc2n1.Nc1ncccc1C=O.
What is the InChIKey of 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one?
The InChIKey is HZEQRXFHONUKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C6H6N2O.C3H6O/c1-7-4-5-8-3-2-6-10-9(8)11-7;7-6-5(4-9)2-1-3-8-6;1-3(2)4/h2-6H,1H3;1-4H,(H2,7,8);1-2H3.
What are the key properties of 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one?
2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one has a molecular weight of 324.38 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyridine-3-carbaldehyde;2-methyl-1,8-naphthyridine;propan-2-one is sourced from PubChem (CID 158631009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).