C26H20Cl4F6N4O5 — CID 158632026
1,2-dichloro-3-(isocyanatomethyl)benzene;3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;ethyl (Z)-3-amino-4,4,4-trifluorobut-2-enoate (PubChem CID 158632026) has the molecular formula C26H20Cl4F6N4O5 and a molecular weight of 724.27 g/mol. Its IUPAC name is 1,2-dichloro-3-(isocyanatomethyl)benzene;3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;ethyl (Z)-3-amino-4,4,4-trifluorobut-2-enoate.
| Compound Name | 1,2-dichloro-3-(isocyanatomethyl)benzene;3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;ethyl (Z)-3-amino-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 158632026 |
| Molecular Formula | C26H20Cl4F6N4O5 |
| Molecular Weight | 724.27 g/mol |
| Exact Mass | 722.01 |
| IUPAC Name | 1,2-dichloro-3-(isocyanatomethyl)benzene;3-[(2,3-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;ethyl (Z)-3-amino-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(\N)C(F)(F)F.O=C=NCc1cccc(Cl)c1Cl.O=c1cc(C(F)(F)F)[nH]c(=O)n1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H7Cl2F3N2O2.C8H5Cl2NO.C6H8F3NO2/c13-7-3-1-2-6(10(7)14)5-19-9(20)4-8(12(15,16)17)18-11(19)21;9-7-3-1-2-6(8(7)10)4-11-5-12;1-2-12-5(11)3-4(10)6(7,8)9/h1-4H,5H2,(H,18,21);1-3H,4H2;3H,2,10H2,1H3/b;;4-3- |
| InChIKey | HZHVOOWIMZOCBG-PWIAZYAQSA-N |
| XLogP | 6.69 |
| TPSA | 136.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.27 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|