C65H55B9F9O28S3-3 — CID 158633081
CID 158633081 (PubChem CID 158633081) has the molecular formula C65H55B9F9O28S3-3 and a molecular weight of 1648.62 g/mol.
| Compound Name | CID 158633081 |
|---|---|
| PubChem CID | 158633081 |
| Molecular Formula | C65H55B9F9O28S3-3 |
| Molecular Weight | 1648.62 g/mol |
| Exact Mass | 1649.28 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(C[B])c(C(=O)OC2C3CC4C(OC(=O)C42)C3C(=O)OC(CS(=O)(=O)[O-])C(F)(F)F)c1.[B]Cc1cc(C[B])c(C[B])c(C(=O)OC2C3CC4C2OC(=O)C4C3C(=O)OC(CS(=O)(=O)[O-])C(F)(F)F)c1.[B]Cc1cc(C[B])c(C[B])c(C(=O)OC2C3OC(=O)C4C3OC2C4C(=O)OC(CS(=O)(=O)[O-])C(F)(F)F)c1 |
| InChI | InChI=1S/2C22H20B3F3O9S.C21H18B3F3O10S/c23-4-8-1-9(5-24)13(6-25)10(2-8)19(29)36-17-11-3-12-16(17)21(31)37-18(12)15(11)20(30)35-14(22(26,27)28)7-38(32,33)34;23-4-8-1-9(5-24)13(6-25)10(2-8)19(29)36-17-11-3-12-16(21(31)37-18(12)17)15(11)20(30)35-14(22(26,27)28)7-38(32,33)34;22-3-7-1-8(4-23)10(5-24)9(2-7)18(28)36-16-14-12(13-15(35-14)17(16)37-20(13)30)19(29)34-11(21(25,26)27)6-38(31,32)33/h2*1-2,11-12,14-18H,3-7H2,(H,32,33,34);1-2,11-17H,3-6H2,(H,31,32,33)/p-3 |
| InChIKey | OADQBFPKUPSCTF-UHFFFAOYSA-K |
| XLogP | -0.74 |
| TPSA | 417.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 114 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1648.62 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|