C26H22FN7O3 — CID 158633964
1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]-3-fluorobut-3-en-2-one (PubChem CID 158633964) has the molecular formula C26H22FN7O3 and a molecular weight of 499.51 g/mol. Its IUPAC name is 1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]-3-fluorobut-3-en-2-one.
| Compound Name | 1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]-3-fluorobut-3-en-2-one |
|---|---|
| PubChem CID | 158633964 |
| Molecular Formula | C26H22FN7O3 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]-3-fluorobut-3-en-2-one |
| SMILES | C=C(F)C(=O)Cc1cc2c(Nc3ccc(Oc4cc5nncn5cn4)c(C)c3)ncnc2cc1OCC |
| InChI | InChI=1S/C26H22FN7O3/c1-4-36-23-10-20-19(8-17(23)9-21(35)16(3)27)26(29-12-28-20)32-18-5-6-22(15(2)7-18)37-25-11-24-33-31-14-34(24)13-30-25/h5-8,10-14H,3-4,9H2,1-2H3,(H,28,29,32) |
| InChIKey | MGBAACSIXCKQKT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|