About 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane
2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane (PubChem CID 158635524) has the molecular formula C23H42ClNO3
and a molecular weight of 416.05 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane |
| PubChem CID | 158635524 |
| Molecular Formula | C23H42ClNO3 |
| Molecular Weight | 416.05 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane |
| SMILES | C.O=C(CC12CC3CC(CC(C3)C1)C2)NCCOCCOCCCCCCCl |
| InChI | InChI=1S/C22H38ClNO3.CH4/c23-5-3-1-2-4-7-26-9-10-27-8-6-24-21(25)17-22-14-18-11-19(15-22)13-20(12-18)16-22;/h18-20H,1-17H2,(H,24,25);1H4 |
| InChIKey | HZSLKCLVHQHVMC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.05 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane?
The IUPAC name of 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane (CID 158635524) is 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane.
What is the SMILES notation for 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane?
The canonical SMILES for 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane is C.O=C(CC12CC3CC(CC(C3)C1)C2)NCCOCCOCCCCCCCl.
What is the InChIKey of 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane?
The InChIKey is HZSLKCLVHQHVMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38ClNO3.CH4/c23-5-3-1-2-4-7-26-9-10-27-8-6-24-21(25)17-22-14-18-11-19(15-22)13-20(12-18)16-22;/h18-20H,1-17H2,(H,24,25);1H4.
What are the key properties of 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane?
2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane has a molecular weight of 416.05 g/mol, XLogP of 5.18, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide;methane is sourced from PubChem (CID 158635524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).