C21H19FNO7P — CID 158636356
1-[(4aR,6R,7aS)-2-(naphthalen-1-ylmethoxy)-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione (PubChem CID 158636356) has the molecular formula C21H19FNO7P and a molecular weight of 447.36 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-2-(naphthalen-1-ylmethoxy)-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aS)-2-(naphthalen-1-ylmethoxy)-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione |
|---|---|
| PubChem CID | 158636356 |
| Molecular Formula | C21H19FNO7P |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 1-[(4aR,6R,7aS)-2-(naphthalen-1-ylmethoxy)-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione |
| SMILES | O=C1CC(=O)N([C@H]2C[C@@H]3OP(=O)(OCc4cccc5ccccc45)OC[C@H]3O2)C=C1F |
| InChI | InChI=1S/C21H19FNO7P/c22-16-10-23(20(25)8-17(16)24)21-9-18-19(29-21)12-28-31(26,30-18)27-11-14-6-3-5-13-4-1-2-7-15(13)14/h1-7,10,18-19,21H,8-9,11-12H2/t18-,19+,21+,31?/m0/s1 |
| InChIKey | IKHMGRVZBLATON-YHGCHCFISA-N |
| XLogP | 3.61 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|