About [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol
[(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol (PubChem CID 15863648) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
| PubChem CID | 15863648 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
| SMILES | OC[C@@H]1C2OC2[C@@H]1CO |
| InChI | InChI=1S/C6H10O3/c7-1-3-4(2-8)6-5(3)9-6/h3-8H,1-2H2/t3-,4+,5?,6? |
| InChIKey | XONWNORMXRUQQC-LAXKNYFCSA-N |
| XLogP | -1.02 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
The IUPAC name of [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol (CID 15863648) is [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol.
What is the SMILES notation for [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
The canonical SMILES for [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol is OC[C@@H]1C2OC2[C@@H]1CO.
What is the InChIKey of [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
The InChIKey is XONWNORMXRUQQC-LAXKNYFCSA-N. The full InChI is InChI=1S/C6H10O3/c7-1-3-4(2-8)6-5(3)9-6/h3-8H,1-2H2/t3-,4+,5?,6?.
What are the key properties of [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
[(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol has a molecular weight of 130.14 g/mol, XLogP of -1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol is sourced from PubChem (CID 15863648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).