C42H68N8S4 — CID 158638610
(6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methyl N,N'-dicyclohexylcarbamimidothioate (PubChem CID 158638610) has the molecular formula C42H68N8S4 and a molecular weight of 813.33 g/mol. Its IUPAC name is (6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methyl N,N'-dicyclohexylcarbamimidothioate.
| Compound Name | (6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methyl N,N'-dicyclohexylcarbamimidothioate |
|---|---|
| PubChem CID | 158638610 |
| Molecular Formula | C42H68N8S4 |
| Molecular Weight | 813.33 g/mol |
| Exact Mass | 812.44 |
| IUPAC Name | (6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methyl N,N'-dicyclohexylcarbamimidothioate |
| SMILES | CC1(C)CN2C(CS/C(=N\C3CCCCC3)NC3CCCCC3)=CSC2=N1.CC1(C)CN2C(CS/C(=N\C3CCCCC3)NC3CCCCC3)=CSC2=N1 |
| InChI | InChI=1S/2C21H34N4S2/c2*1-21(2)15-25-18(14-27-20(25)24-21)13-26-19(22-16-9-5-3-6-10-16)23-17-11-7-4-8-12-17/h2*14,16-17H,3-13,15H2,1-2H3,(H,22,23) |
| InChIKey | IABXCXBWIKEXEY-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.33 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|