About 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride
2-cyanocyclopropane-1-carboxylic acid;dihydrochloride (PubChem CID 158639721) has the molecular formula C5H7Cl2NO2
and a molecular weight of 184.02 g/mol. Its IUPAC name is 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride |
| PubChem CID | 158639721 |
| Molecular Formula | C5H7Cl2NO2 |
| Molecular Weight | 184.02 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.N#CC1CC1C(=O)O |
| InChI | InChI=1S/C5H5NO2.2ClH/c6-2-3-1-4(3)5(7)8;;/h3-4H,1H2,(H,7,8);2*1H |
| InChIKey | IAFNNLARYJZVMN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.02 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride?
The IUPAC name of 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride (CID 158639721) is 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride.
What is the SMILES notation for 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride?
The canonical SMILES for 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride is Cl.Cl.N#CC1CC1C(=O)O.
What is the InChIKey of 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride?
The InChIKey is IAFNNLARYJZVMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.2ClH/c6-2-3-1-4(3)5(7)8;;/h3-4H,1H2,(H,7,8);2*1H.
What are the key properties of 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride?
2-cyanocyclopropane-1-carboxylic acid;dihydrochloride has a molecular weight of 184.02 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanocyclopropane-1-carboxylic acid;dihydrochloride is sourced from PubChem (CID 158639721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).