About CID 158639732
CID 158639732 (PubChem CID 158639732) has the molecular formula C57H62Cl2N8O2+2
and a molecular weight of 962.08 g/mol.
Molecular Properties
| Compound Name | CID 158639732 |
| PubChem CID | 158639732 |
| Molecular Formula | C57H62Cl2N8O2+2 |
| Molecular Weight | 962.08 g/mol |
| Exact Mass | 960.44 |
| IUPAC Name | — |
| SMILES | Clc1ccc2c(c1)cc(CCCn1ccnc1)c1cccnc1[c+]2C1CCNCC1.O=C(OC1CCCCC1)N1CCC(c2c3ncccc3c(CCCn3ccnc3)c[c+]3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C32H36ClN4O2.C25H26ClN4/c33-26-10-11-28-25(21-26)20-24(6-5-16-36-19-15-34-22-36)29-9-4-14-35-31(29)30(28)23-12-17-37(18-13-23)32(38)39-27-7-2-1-3-8-27;26-21-5-6-22-20(16-21)15-19(3-2-13-30-14-12-28-17-30)23-4-1-9-29-25(23)24(22)18-7-10-27-11-8-18/h4,9-11,14-15,19-23,27H,1-3,5-8,12-13,16-18H2;1,4-6,9,12,14-18,27H,2-3,7-8,10-11,13H2/q2*+1 |
| InChIKey | IAFOKSPIRWHLCN-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 962.08 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 158639732 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158639732?
The IUPAC name of CID 158639732 (CID 158639732) is not available.
What is the SMILES notation for CID 158639732?
The canonical SMILES for CID 158639732 is Clc1ccc2c(c1)cc(CCCn1ccnc1)c1cccnc1[c+]2C1CCNCC1.O=C(OC1CCCCC1)N1CCC(c2c3ncccc3c(CCCn3ccnc3)c[c+]3cc(Cl)ccc23)CC1.
What is the InChIKey of CID 158639732?
The InChIKey is IAFOKSPIRWHLCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H36ClN4O2.C25H26ClN4/c33-26-10-11-28-25(21-26)20-24(6-5-16-36-19-15-34-22-36)29-9-4-14-35-31(29)30(28)23-12-17-37(18-13-23)32(38)39-27-7-2-1-3-8-27;26-21-5-6-22-20(16-21)15-19(3-2-13-30-14-12-28-17-30)23-4-1-9-29-25(23)24(22)18-7-10-27-11-8-18/h4,9-11,14-15,19-23,27H,1-3,5-8,12-13,16-18H2;1,4-6,9,12,14-18,27H,2-3,7-8,10-11,13H2/q2*+1.
What are the key properties of CID 158639732?
CID 158639732 has a molecular weight of 962.08 g/mol, XLogP of 13.42, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158639732 is sourced from PubChem (CID 158639732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).