C39H23N3 — CID 158640756
10-[4-(3,5-diisocyanophenyl)phenyl]spiro[acridine-9,9'-fluorene] (PubChem CID 158640756) has the molecular formula C39H23N3 and a molecular weight of 533.63 g/mol. Its IUPAC name is 10-[4-(3,5-diisocyanophenyl)phenyl]spiro[acridine-9,9'-fluorene].
| Compound Name | 10-[4-(3,5-diisocyanophenyl)phenyl]spiro[acridine-9,9'-fluorene] |
|---|---|
| PubChem CID | 158640756 |
| Molecular Formula | C39H23N3 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 10-[4-(3,5-diisocyanophenyl)phenyl]spiro[acridine-9,9'-fluorene] |
| SMILES | [C-]#[N+]c1cc([N+]#[C-])cc(-c2ccc(N3c4ccccc4C4(c5ccccc5-c5ccccc54)c4ccccc43)cc2)c1 |
| InChI | InChI=1S/C39H23N3/c1-40-28-23-27(24-29(25-28)41-2)26-19-21-30(22-20-26)42-37-17-9-7-15-35(37)39(36-16-8-10-18-38(36)42)33-13-5-3-11-31(33)32-12-4-6-14-34(32)39/h3-25H |
| InChIKey | KPFKHZRFEHOREU-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 11.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|