C17H25FN2O2 — CID 158641052
[5-amino-2-fluoro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate (PubChem CID 158641052) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is [5-amino-2-fluoro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate.
| Compound Name | [5-amino-2-fluoro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 158641052 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | [5-amino-2-fluoro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(N)c(N[C@H]2C[C@@H](C)CC(C)(C)C2)cc1F |
| InChI | InChI=1S/C17H25FN2O2/c1-10-5-12(9-17(3,4)8-10)20-15-6-13(18)16(7-14(15)19)22-11(2)21/h6-7,10,12,20H,5,8-9,19H2,1-4H3/t10-,12+/m1/s1 |
| InChIKey | IAJSVACZMDFBOY-PWSUYJOCSA-N |
| XLogP | 3.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|