About 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline
5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline (PubChem CID 158642295) has the molecular formula C26H22N4O4
and a molecular weight of 454.49 g/mol. Its IUPAC name is 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline.
Molecular Properties
| Compound Name | 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline |
| PubChem CID | 158642295 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline |
| SMILES | CCC#Cc1ccc(N)cc1-c1cnco1.CCC#Cc1ccc([N+](=O)[O-])cc1-c1cnco1 |
| InChI | InChI=1S/C13H10N2O3.C13H12N2O/c1-2-3-4-10-5-6-11(15(16)17)7-12(10)13-8-14-9-18-13;1-2-3-4-10-5-6-11(14)7-12(10)13-8-15-9-16-13/h5-9H,2H2,1H3;5-9H,2,14H2,1H3 |
| InChIKey | IANRVZYBYLNQQM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline?
The IUPAC name of 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline (CID 158642295) is 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline.
What is the SMILES notation for 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline?
The canonical SMILES for 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline is CCC#Cc1ccc(N)cc1-c1cnco1.CCC#Cc1ccc([N+](=O)[O-])cc1-c1cnco1.
What is the InChIKey of 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline?
The InChIKey is IANRVZYBYLNQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3.C13H12N2O/c1-2-3-4-10-5-6-11(15(16)17)7-12(10)13-8-14-9-18-13;1-2-3-4-10-5-6-11(14)7-12(10)13-8-15-9-16-13/h5-9H,2H2,1H3;5-9H,2,14H2,1H3.
What are the key properties of 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline?
5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline has a molecular weight of 454.49 g/mol, XLogP of 5.70, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-but-1-ynyl-5-nitrophenyl)-1,3-oxazole;4-but-1-ynyl-3-(1,3-oxazol-5-yl)aniline is sourced from PubChem (CID 158642295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).