About 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione
4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione (PubChem CID 158642932) has the molecular formula C18H14N4O6
and a molecular weight of 382.33 g/mol. Its IUPAC name is 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione.
Molecular Properties
| Compound Name | 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione |
| PubChem CID | 158642932 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione |
| SMILES | Cc1c([N+](=O)[O-])ccc2[nH]ccc12.Cc1c([N+](=O)[O-])ccc2c1C(=O)C(=O)N2 |
| InChI | InChI=1S/C9H6N2O4.C9H8N2O2/c1-4-6(11(14)15)3-2-5-7(4)8(12)9(13)10-5;1-6-7-4-5-10-8(7)2-3-9(6)11(12)13/h2-3H,1H3,(H,10,12,13);2-5,10H,1H3 |
| InChIKey | IAPPPWNLNAHZHA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione?
The IUPAC name of 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione (CID 158642932) is 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione.
What is the SMILES notation for 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione?
The canonical SMILES for 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione is Cc1c([N+](=O)[O-])ccc2[nH]ccc12.Cc1c([N+](=O)[O-])ccc2c1C(=O)C(=O)N2.
What is the InChIKey of 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione?
The InChIKey is IAPPPWNLNAHZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O4.C9H8N2O2/c1-4-6(11(14)15)3-2-5-7(4)8(12)9(13)10-5;1-6-7-4-5-10-8(7)2-3-9(6)11(12)13/h2-3H,1H3,(H,10,12,13);2-5,10H,1H3.
What are the key properties of 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione?
4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione has a molecular weight of 382.33 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-nitro-1H-indole;4-methyl-5-nitro-1H-indole-2,3-dione is sourced from PubChem (CID 158642932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).