C19H23N3O7 — CID 158645536
N-ethyl-N-[2-(4-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide;methane (PubChem CID 158645536) has the molecular formula C19H23N3O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-ethyl-N-[2-(4-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide;methane.
| Compound Name | N-ethyl-N-[2-(4-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide;methane |
|---|---|
| PubChem CID | 158645536 |
| Molecular Formula | C19H23N3O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-ethyl-N-[2-(4-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide;methane |
| SMILES | C.CCN(CCOc1ccc(OC)cc1)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O7.CH4/c1-3-19(8-9-28-17-6-4-16(27-2)5-7-17)18(22)13-10-14(20(23)24)12-15(11-13)21(25)26;/h4-7,10-12H,3,8-9H2,1-2H3;1H4 |
| InChIKey | IAXMLAGTOSCRAT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|