About CID 158646308
CID 158646308 (PubChem CID 158646308) has the molecular formula C45H30B4N4O2Pt
and a molecular weight of 897.09 g/mol.
Molecular Properties
| Compound Name | CID 158646308 |
| PubChem CID | 158646308 |
| Molecular Formula | C45H30B4N4O2Pt |
| Molecular Weight | 897.09 g/mol |
| Exact Mass | 897.24 |
| IUPAC Name | — |
| SMILES | [B]B([B])[B].[Pt+2].[c-]1cc2oc3ccccc3c2cc1-n1ccc(C(Cc2ccccc2)(Cc2ccccc2)c2ccn(-c3[c-]cc4oc5ccccc5c4c3)n2)n1 |
| InChI | InChI=1S/C45H30N4O2.B4.Pt/c1-3-11-31(12-4-1)29-45(30-32-13-5-2-6-14-32,43-23-25-48(46-43)33-19-21-41-37(27-33)35-15-7-9-17-39(35)50-41)44-24-26-49(47-44)34-20-22-42-38(28-34)36-16-8-10-18-40(36)51-42;1-4(2)3;/h1-18,21-28H,29-30H2;;/q-2;;+2 |
| InChIKey | MPKOVQMDXIIXIF-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 897.09 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158646308 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158646308?
The IUPAC name of CID 158646308 (CID 158646308) is not available.
What is the SMILES notation for CID 158646308?
The canonical SMILES for CID 158646308 is [B]B([B])[B].[Pt+2].[c-]1cc2oc3ccccc3c2cc1-n1ccc(C(Cc2ccccc2)(Cc2ccccc2)c2ccn(-c3[c-]cc4oc5ccccc5c4c3)n2)n1.
What is the InChIKey of CID 158646308?
The InChIKey is MPKOVQMDXIIXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H30N4O2.B4.Pt/c1-3-11-31(12-4-1)29-45(30-32-13-5-2-6-14-32,43-23-25-48(46-43)33-19-21-41-37(27-33)35-15-7-9-17-39(35)50-41)44-24-26-49(47-44)34-20-22-42-38(28-34)36-16-8-10-18-40(36)51-42;1-4(2)3;/h1-18,21-28H,29-30H2;;/q-2;;+2.
What are the key properties of CID 158646308?
CID 158646308 has a molecular weight of 897.09 g/mol, XLogP of 8.70, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158646308 is sourced from PubChem (CID 158646308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).