About tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride
tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride (PubChem CID 158646592) has the molecular formula C22H39Cl3N4O6
and a molecular weight of 561.94 g/mol. Its IUPAC name is tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride.
Molecular Properties
| Compound Name | tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride |
| PubChem CID | 158646592 |
| Molecular Formula | C22H39Cl3N4O6 |
| Molecular Weight | 561.94 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1.CC(C)(C)OC(=O)N1CCNCC1.O=C(Cl)CCl |
| InChI | InChI=1S/C11H19ClN2O3.C9H18N2O2.C2H2Cl2O/c1-11(2,3)17-10(16)14-6-4-13(5-7-14)9(15)8-12;1-9(2,3)13-8(12)11-6-4-10-5-7-11;3-1-2(4)5/h4-8H2,1-3H3;10H,4-7H2,1-3H3;1H2 |
| InChIKey | IBAVHQORAUVYFG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 561.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride?
The IUPAC name of tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride (CID 158646592) is tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride.
What is the SMILES notation for tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride?
The canonical SMILES for tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride is CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1.CC(C)(C)OC(=O)N1CCNCC1.O=C(Cl)CCl.
What is the InChIKey of tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride?
The InChIKey is IBAVHQORAUVYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClN2O3.C9H18N2O2.C2H2Cl2O/c1-11(2,3)17-10(16)14-6-4-13(5-7-14)9(15)8-12;1-9(2,3)13-8(12)11-6-4-10-5-7-11;3-1-2(4)5/h4-8H2,1-3H3;10H,4-7H2,1-3H3;1H2.
What are the key properties of tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride?
tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride has a molecular weight of 561.94 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;2-chloroacetyl chloride is sourced from PubChem (CID 158646592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).