C74H88F2N2O14S4 — CID 158646794
4-O-tert-butyl 1-O-[(3R)-3-(4-fluorophenyl)-5-oxo-5-[(2S)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]pentyl] (2S)-2-propan-2-ylbutanedioate (PubChem CID 158646794) has the molecular formula C74H88F2N2O14S4 and a molecular weight of 1395.78 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(3R)-3-(4-fluorophenyl)-5-oxo-5-[(2S)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]pentyl] (2S)-2-propan-2-ylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(3R)-3-(4-fluorophenyl)-5-oxo-5-[(2S)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]pentyl] (2S)-2-propan-2-ylbutanedioate |
|---|---|
| PubChem CID | 158646794 |
| Molecular Formula | C74H88F2N2O14S4 |
| Molecular Weight | 1395.78 g/mol |
| Exact Mass | 1394.51 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(3R)-3-(4-fluorophenyl)-5-oxo-5-[(2S)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]pentyl] (2S)-2-propan-2-ylbutanedioate |
| SMILES | CC(C)[C@H](CC(=O)OC(C)(C)C)C(=O)OCC[C@H](CC(=O)[C@@H]1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1)c1ccc(F)cc1.CC(C)[C@H](CC(=O)OC(C)(C)C)C(=O)OCC[C@H](CC(=O)[C@@H]1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/2C37H44FNO7S2/c2*1-25(2)32(24-34(41)46-37(3,4)5)36(42)45-21-19-29(28-11-15-30(38)16-12-28)23-33(40)35-39(20-22-47-35)48(43,44)31-17-13-27(14-18-31)26-9-7-6-8-10-26/h2*6-18,25,29,32,35H,19-24H2,1-5H3/t2*29-,32+,35+/m11/s1 |
| InChIKey | IBBIHIFFKJKBKC-SKHZNQTRSA-N |
| XLogP | 14.47 |
| TPSA | 214.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1395.78 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|