About [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene
[1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene (PubChem CID 158647158) has the molecular formula C19H28O2S
and a molecular weight of 320.50 g/mol. Its IUPAC name is [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene.
Molecular Properties
| Compound Name | [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene |
| PubChem CID | 158647158 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene |
| SMILES | CC(C)(C)C/C=C\CCS(=O)(=O)CC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28O2S/c1-18(2,3)12-8-5-9-15-22(20,21)16-19(13-14-19)17-10-6-4-7-11-17/h4-8,10-11H,9,12-16H2,1-3H3/b8-5- |
| InChIKey | QCMRJRICYFJHTJ-YVMONPNESA-N |
| XLogP | 4.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene?
The IUPAC name of [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene (CID 158647158) is [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene.
What is the SMILES notation for [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene?
The canonical SMILES for [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene is CC(C)(C)C/C=C\CCS(=O)(=O)CC1(c2ccccc2)CC1.
What is the InChIKey of [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene?
The InChIKey is QCMRJRICYFJHTJ-YVMONPNESA-N. The full InChI is InChI=1S/C19H28O2S/c1-18(2,3)12-8-5-9-15-22(20,21)16-19(13-14-19)17-10-6-4-7-11-17/h4-8,10-11H,9,12-16H2,1-3H3/b8-5-.
What are the key properties of [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene?
[1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene has a molecular weight of 320.50 g/mol, XLogP of 4.52, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(Z)-6,6-dimethylhept-3-enyl]sulfonylmethyl]cyclopropyl]benzene is sourced from PubChem (CID 158647158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).