About N-benzyl-N'-phenylmethoxyethane-1,2-diamine
N-benzyl-N'-phenylmethoxyethane-1,2-diamine (PubChem CID 15864740) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-benzyl-N'-phenylmethoxyethane-1,2-diamine.
Molecular Properties
| Compound Name | N-benzyl-N'-phenylmethoxyethane-1,2-diamine |
| PubChem CID | 15864740 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-benzyl-N'-phenylmethoxyethane-1,2-diamine |
| SMILES | c1ccc(CNCCNOCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2O/c1-3-7-15(8-4-1)13-17-11-12-18-19-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | YOANQUABLNHQLU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-phenylmethoxyethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-phenylmethoxyethane-1,2-diamine?
The IUPAC name of N-benzyl-N'-phenylmethoxyethane-1,2-diamine (CID 15864740) is N-benzyl-N'-phenylmethoxyethane-1,2-diamine.
What is the SMILES notation for N-benzyl-N'-phenylmethoxyethane-1,2-diamine?
The canonical SMILES for N-benzyl-N'-phenylmethoxyethane-1,2-diamine is c1ccc(CNCCNOCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-N'-phenylmethoxyethane-1,2-diamine?
The InChIKey is YOANQUABLNHQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O/c1-3-7-15(8-4-1)13-17-11-12-18-19-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2.
What are the key properties of N-benzyl-N'-phenylmethoxyethane-1,2-diamine?
N-benzyl-N'-phenylmethoxyethane-1,2-diamine has a molecular weight of 256.35 g/mol, XLogP of 2.50, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-phenylmethoxyethane-1,2-diamine is sourced from PubChem (CID 15864740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).