C20H17ClN4 — CID 158648130
9-(2-chlorophenyl)-12-cyclopropyl-6-methyl-2,4,8,13-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene (PubChem CID 158648130) has the molecular formula C20H17ClN4 and a molecular weight of 348.84 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-12-cyclopropyl-6-methyl-2,4,8,13-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene.
| Compound Name | 9-(2-chlorophenyl)-12-cyclopropyl-6-methyl-2,4,8,13-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene |
|---|---|
| PubChem CID | 158648130 |
| Molecular Formula | C20H17ClN4 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 9-(2-chlorophenyl)-12-cyclopropyl-6-methyl-2,4,8,13-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene |
| SMILES | CC1=C2N=C(c3ccccc3Cl)c3cc(C4CC4)ncc3NC2=NC1 |
| InChI | InChI=1S/C20H17ClN4/c1-11-9-23-20-18(11)25-19(13-4-2-3-5-15(13)21)14-8-16(12-6-7-12)22-10-17(14)24-20/h2-5,8,10,12H,6-7,9H2,1H3,(H,23,24) |
| InChIKey | MUVFVDNHOMVLGF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |