About 1H-imidazole;1H-indene;1H-pyrrole
1H-imidazole;1H-indene;1H-pyrrole (PubChem CID 158648814) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 1H-imidazole;1H-indene;1H-pyrrole.
Molecular Properties
| Compound Name | 1H-imidazole;1H-indene;1H-pyrrole |
| PubChem CID | 158648814 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1H-imidazole;1H-indene;1H-pyrrole |
| SMILES | C1=Cc2ccccc2C1.c1c[nH]cn1.c1cc[nH]c1 |
| InChI | InChI=1S/C9H8.C4H5N.C3H4N2/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-5-3-1;1-2-5-3-4-1/h1-6H,7H2;1-5H;1-3H,(H,4,5) |
| InChIKey | IBHJBOAXOZOLPW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-imidazole;1H-indene;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;1H-indene;1H-pyrrole?
The IUPAC name of 1H-imidazole;1H-indene;1H-pyrrole (CID 158648814) is 1H-imidazole;1H-indene;1H-pyrrole.
What is the SMILES notation for 1H-imidazole;1H-indene;1H-pyrrole?
The canonical SMILES for 1H-imidazole;1H-indene;1H-pyrrole is C1=Cc2ccccc2C1.c1c[nH]cn1.c1cc[nH]c1.
What is the InChIKey of 1H-imidazole;1H-indene;1H-pyrrole?
The InChIKey is IBHJBOAXOZOLPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C4H5N.C3H4N2/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-5-3-1;1-2-5-3-4-1/h1-6H,7H2;1-5H;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;1H-indene;1H-pyrrole?
1H-imidazole;1H-indene;1H-pyrrole has a molecular weight of 251.33 g/mol, XLogP of 3.68, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;1H-indene;1H-pyrrole is sourced from PubChem (CID 158648814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).