About methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen
methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen (PubChem CID 158650215) has the molecular formula C19H24Br2N4O4
and a molecular weight of 532.23 g/mol. Its IUPAC name is methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen |
| PubChem CID | 158650215 |
| Molecular Formula | C19H24Br2N4O4 |
| Molecular Weight | 532.23 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen |
| SMILES | COC(=O)c1n[nH]c2cc(Br)ccc12.COC(=O)c1nn(C)c2cc(Br)ccc12.[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C10H9BrN2O2.C9H7BrN2O2.4H2/c1-13-8-5-6(11)3-4-7(8)9(12-13)10(14)15-2;1-14-9(13)8-6-3-2-5(10)4-7(6)11-12-8;;;;/h3-5H,1-2H3;2-4H,1H3,(H,11,12);4*1H |
| InChIKey | IBLNKGHHOUWGIH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.23 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen?
The IUPAC name of methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen (CID 158650215) is methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen.
What is the SMILES notation for methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen?
The canonical SMILES for methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen is COC(=O)c1n[nH]c2cc(Br)ccc12.COC(=O)c1nn(C)c2cc(Br)ccc12.[H][H].[H][H].[H][H].[H][H].
What is the InChIKey of methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen?
The InChIKey is IBLNKGHHOUWGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O2.C9H7BrN2O2.4H2/c1-13-8-5-6(11)3-4-7(8)9(12-13)10(14)15-2;1-14-9(13)8-6-3-2-5(10)4-7(6)11-12-8;;;;/h3-5H,1-2H3;2-4H,1H3,(H,11,12);4*1H.
What are the key properties of methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen?
methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen has a molecular weight of 532.23 g/mol, XLogP of 5.22, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-1H-indazole-3-carboxylate;methyl 6-bromo-1-methylindazole-3-carboxylate;molecular hydrogen is sourced from PubChem (CID 158650215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).