C65H56N4O8 — CID 158650735
bis(7-methyl-18-pentyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone);pentane (PubChem CID 158650735) has the molecular formula C65H56N4O8 and a molecular weight of 1021.18 g/mol. Its IUPAC name is bis(7-methyl-18-pentyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone);pentane.
| Compound Name | bis(7-methyl-18-pentyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone);pentane |
|---|---|
| PubChem CID | 158650735 |
| Molecular Formula | C65H56N4O8 |
| Molecular Weight | 1021.18 g/mol |
| Exact Mass | 1020.41 |
| IUPAC Name | bis(7-methyl-18-pentyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone);pentane |
| SMILES | CCCCC.CCCCCN1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(C)C5=O.CCCCCN1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(C)C5=O |
| InChI | InChI=1S/2C30H22N2O4.C5H12/c2*1-3-4-5-14-32-29(35)21-12-8-17-15-6-10-19-25-20(28(34)31(2)27(19)33)11-7-16(23(15)25)18-9-13-22(30(32)36)26(21)24(17)18;1-3-5-4-2/h2*6-13H,3-5,14H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | IBNDHSRVULMYAH-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.18 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|