About CID 15865189
CID 15865189 (PubChem CID 15865189) has the molecular formula C15H25N2
and a molecular weight of 233.38 g/mol.
Molecular Properties
| Compound Name | CID 15865189 |
| PubChem CID | 15865189 |
| Molecular Formula | C15H25N2 |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | — |
| SMILES | [CH]1N(C2CCCCC2)C=CN1C1CCCCC1 |
| InChI | InChI=1S/C15H25N2/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15/h11-15H,1-10H2 |
| InChIKey | LXCDBIYPACSRBR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 15865189 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15865189?
The IUPAC name of CID 15865189 (CID 15865189) is not available.
What is the SMILES notation for CID 15865189?
The canonical SMILES for CID 15865189 is [CH]1N(C2CCCCC2)C=CN1C1CCCCC1.
What is the InChIKey of CID 15865189?
The InChIKey is LXCDBIYPACSRBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N2/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15/h11-15H,1-10H2.
What are the key properties of CID 15865189?
CID 15865189 has a molecular weight of 233.38 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15865189 is sourced from PubChem (CID 15865189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).