C20H35F4NO — CID 158651896
2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;methane (PubChem CID 158651896) has the molecular formula C20H35F4NO and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;methane.
| Compound Name | 2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;methane |
|---|---|
| PubChem CID | 158651896 |
| Molecular Formula | C20H35F4NO |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;methane |
| SMILES | C.CC(C)(C)NC(CC1CCC2(CC1)C(F)(F)C2(F)F)C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H31F4NO.CH4/c1-15(2,3)14(25)13(24-16(4,5)6)11-12-7-9-17(10-8-12)18(20,21)19(17,22)23;/h12-13,24H,7-11H2,1-6H3;1H4 |
| InChIKey | IBQUFIHPDTVJAH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|