About piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate
piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate (PubChem CID 158652223) has the molecular formula C11H24N4S2
and a molecular weight of 276.47 g/mol. Its IUPAC name is piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate.
Molecular Properties
| Compound Name | piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate |
| PubChem CID | 158652223 |
| Molecular Formula | C11H24N4S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate |
| SMILES | S=C([S-])NN1CCCCC1.[NH3+]N1CCCCC1 |
| InChI | InChI=1S/C6H12N2S2.C5H12N2/c9-6(10)7-8-4-2-1-3-5-8;6-7-4-2-1-3-5-7/h1-5H2,(H2,7,9,10);1-6H2 |
| InChIKey | IBRRRGUOLIRHOB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate?
The IUPAC name of piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate (CID 158652223) is piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate.
What is the SMILES notation for piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate?
The canonical SMILES for piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate is S=C([S-])NN1CCCCC1.[NH3+]N1CCCCC1.
What is the InChIKey of piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate?
The InChIKey is IBRRRGUOLIRHOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S2.C5H12N2/c9-6(10)7-8-4-2-1-3-5-8;6-7-4-2-1-3-5-7/h1-5H2,(H2,7,9,10);1-6H2.
What are the key properties of piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate?
piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate has a molecular weight of 276.47 g/mol, XLogP of 0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-ylazanium;N-piperidin-1-ylcarbamodithioate is sourced from PubChem (CID 158652223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).