C28H48O6 — CID 158653710
acetyl acetate;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-ol;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-yl acetate (PubChem CID 158653710) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is acetyl acetate;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-ol;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-yl acetate.
| Compound Name | acetyl acetate;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-ol;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-yl acetate |
|---|---|
| PubChem CID | 158653710 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | acetyl acetate;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-ol;2-(2,4-dimethylcyclohex-3-en-1-yl)propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)C1CCC(C)=CC1C.CC(=O)OC(C)=O.CC1=CC(C)C(C(C)(C)O)CC1 |
| InChI | InChI=1S/C13H22O2.C11H20O.C4H6O3/c1-9-6-7-12(10(2)8-9)13(4,5)15-11(3)14;1-8-5-6-10(9(2)7-8)11(3,4)12;1-3(5)7-4(2)6/h8,10,12H,6-7H2,1-5H3;7,9-10,12H,5-6H2,1-4H3;1-2H3 |
| InChIKey | IBWDZTPQRLGHCR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|