C28H42ClN7O5 — CID 158654195
N-[(2S,5R,10R,13R)-5-(4-chlorophenyl)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide (PubChem CID 158654195) has the molecular formula C28H42ClN7O5 and a molecular weight of 592.14 g/mol. Its IUPAC name is N-[(2S,5R,10R,13R)-5-(4-chlorophenyl)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide.
| Compound Name | N-[(2S,5R,10R,13R)-5-(4-chlorophenyl)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 158654195 |
| Molecular Formula | C28H42ClN7O5 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | N-[(2S,5R,10R,13R)-5-(4-chlorophenyl)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCN=C(N)N)CC(=O)[C@](C)(NC(=O)C(C)C)CCNC(=O)[C@@H](c2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C28H42ClN7O5/c1-5-20-25(40)35-22(17-8-10-19(29)11-9-17)26(41)32-14-12-28(4,36-23(38)16(2)3)21(37)15-18(24(39)34-20)7-6-13-33-27(30)31/h8-11,16,18,20,22H,5-7,12-15H2,1-4H3,(H,32,41)(H,34,39)(H,35,40)(H,36,38)(H4,30,31,33)/t18-,20+,22-,28-/m1/s1 |
| InChIKey | IBXRLLWRDBCQRZ-QKCDZWGCSA-N |
| XLogP | 1.07 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|