C20H15N3O7 — CID 158655103
5-hydroxy-3-methoxy-7-oxo-8H-isoquinoline-6-carbonitrile;7-methoxy-4H-pyrano[4,3-c]pyridine-1,3-dione (PubChem CID 158655103) has the molecular formula C20H15N3O7 and a molecular weight of 409.35 g/mol. Its IUPAC name is 5-hydroxy-3-methoxy-7-oxo-8H-isoquinoline-6-carbonitrile;7-methoxy-4H-pyrano[4,3-c]pyridine-1,3-dione.
| Compound Name | 5-hydroxy-3-methoxy-7-oxo-8H-isoquinoline-6-carbonitrile;7-methoxy-4H-pyrano[4,3-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 158655103 |
| Molecular Formula | C20H15N3O7 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 5-hydroxy-3-methoxy-7-oxo-8H-isoquinoline-6-carbonitrile;7-methoxy-4H-pyrano[4,3-c]pyridine-1,3-dione |
| SMILES | COc1cc2c(cn1)CC(=O)C(C#N)=C2O.COc1cc2c(cn1)CC(=O)OC2=O |
| InChI | InChI=1S/C11H8N2O3.C9H7NO4/c1-16-10-3-7-6(5-13-10)2-9(14)8(4-12)11(7)15;1-13-7-3-6-5(4-10-7)2-8(11)14-9(6)12/h3,5,15H,2H2,1H3;3-4H,2H2,1H3 |
| InChIKey | ICAMPIMUGAIDKR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 148.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|