C25H29O5P — CID 158655714
[4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] phenyl hydrogen phosphate (PubChem CID 158655714) has the molecular formula C25H29O5P and a molecular weight of 440.48 g/mol. Its IUPAC name is [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] phenyl hydrogen phosphate.
| Compound Name | [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 158655714 |
| Molecular Formula | C25H29O5P |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenyl] phenyl hydrogen phosphate |
| SMILES | COc1c(C)cc(CCc2cc(C)c(OP(=O)(O)Oc3ccccc3)c(C)c2)cc1C |
| InChI | InChI=1S/C25H29O5P/c1-17-13-21(14-18(2)24(17)28-5)11-12-22-15-19(3)25(20(4)16-22)30-31(26,27)29-23-9-7-6-8-10-23/h6-10,13-16H,11-12H2,1-5H3,(H,26,27) |
| InChIKey | GRHFKOWIQXXRJO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|