About 2-ethylguanidine;methane
2-ethylguanidine;methane (PubChem CID 158655752) has the molecular formula C7H25N3
and a molecular weight of 151.30 g/mol. Its IUPAC name is 2-ethylguanidine;methane.
Molecular Properties
| Compound Name | 2-ethylguanidine;methane |
| PubChem CID | 158655752 |
| Molecular Formula | C7H25N3 |
| Molecular Weight | 151.30 g/mol |
| Exact Mass | 151.20 |
| IUPAC Name | 2-ethylguanidine;methane |
| SMILES | C.C.C.C.CCN=C(N)N |
| InChI | InChI=1S/C3H9N3.4CH4/c1-2-6-3(4)5;;;;/h2H2,1H3,(H4,4,5,6);4*1H4 |
| InChIKey | ICCPMGGPAVQFGA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylguanidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylguanidine;methane?
The IUPAC name of 2-ethylguanidine;methane (CID 158655752) is 2-ethylguanidine;methane.
What is the SMILES notation for 2-ethylguanidine;methane?
The canonical SMILES for 2-ethylguanidine;methane is C.C.C.C.CCN=C(N)N.
What is the InChIKey of 2-ethylguanidine;methane?
The InChIKey is ICCPMGGPAVQFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3.4CH4/c1-2-6-3(4)5;;;;/h2H2,1H3,(H4,4,5,6);4*1H4.
What are the key properties of 2-ethylguanidine;methane?
2-ethylguanidine;methane has a molecular weight of 151.30 g/mol, XLogP of 1.82, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylguanidine;methane is sourced from PubChem (CID 158655752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).